C15H23N3O2S — CID 97379228
(3aS,7aR)-4-(2-methoxyethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 97379228) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is (3aS,7aR)-4-(2-methoxyethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aS,7aR)-4-(2-methoxyethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 97379228 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (3aS,7aR)-4-(2-methoxyethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | COCCN1C(=O)CC[C@@H]2[C@@H]1CCN2Cc1csc(C)n1 |
| InChI | InChI=1S/C15H23N3O2S/c1-11-16-12(10-21-11)9-17-6-5-14-13(17)3-4-15(19)18(14)7-8-20-2/h10,13-14H,3-9H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | NSTBOKFRRAZRTR-KGLIPLIRSA-N |
| XLogP | 1.66 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |