C16H20N4OS2 — CID 97379313
(3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 97379313) has the molecular formula C16H20N4OS2 and a molecular weight of 348.50 g/mol. Its IUPAC name is (3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 97379313 |
| Molecular Formula | C16H20N4OS2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | Cc1nc(CN2C(=O)CC[C@@H]3[C@H]2CCN3Cc2nccs2)cs1 |
| InChI | InChI=1S/C16H20N4OS2/c1-11-18-12(10-23-11)8-20-14-4-6-19(9-15-17-5-7-22-15)13(14)2-3-16(20)21/h5,7,10,13-14H,2-4,6,8-9H2,1H3/t13-,14-/m1/s1 |
| InChIKey | CXHFIXTXJAEGOD-ZIAGYGMSSA-N |
| XLogP | 2.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |