C16H21N3O3 — CID 97379962
(3aR,7S,7aS)-2-(furan-3-ylmethyl)-7-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole (PubChem CID 97379962) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is (3aR,7S,7aS)-2-(furan-3-ylmethyl)-7-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole.
| Compound Name | (3aR,7S,7aS)-2-(furan-3-ylmethyl)-7-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
|---|---|
| PubChem CID | 97379962 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (3aR,7S,7aS)-2-(furan-3-ylmethyl)-7-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
| SMILES | Cc1noc(C[C@@H]2COC[C@H]3CN(Cc4ccoc4)C[C@@H]23)n1 |
| InChI | InChI=1S/C16H21N3O3/c1-11-17-16(22-18-11)4-13-9-21-10-14-6-19(7-15(13)14)5-12-2-3-20-8-12/h2-3,8,13-15H,4-7,9-10H2,1H3/t13-,14-,15+/m1/s1 |
| InChIKey | OIHYUEQGLGCJJQ-KFWWJZLASA-N |
| XLogP | 1.91 |
| TPSA | 64.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |