C15H19FN6 — CID 97386457
(3aR,6aS)-4-(5-fluoropyrimidin-2-yl)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 97386457) has the molecular formula C15H19FN6 and a molecular weight of 302.36 g/mol. Its IUPAC name is (3aR,6aS)-4-(5-fluoropyrimidin-2-yl)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aR,6aS)-4-(5-fluoropyrimidin-2-yl)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97386457 |
| Molecular Formula | C15H19FN6 |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (3aR,6aS)-4-(5-fluoropyrimidin-2-yl)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | Cn1cc(CN2CC[C@@H]3[C@@H]2CCN3c2ncc(F)cn2)cn1 |
| InChI | InChI=1S/C15H19FN6/c1-20-9-11(6-19-20)10-21-4-2-14-13(21)3-5-22(14)15-17-7-12(16)8-18-15/h6-9,13-14H,2-5,10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | ZLUWAPWLZMYIAH-UONOGXRCSA-N |
| XLogP | 1.20 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |