C14H21FN4O — CID 97387561
(4aS,8R,8aS)-6-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine (PubChem CID 97387561) has the molecular formula C14H21FN4O and a molecular weight of 280.35 g/mol. Its IUPAC name is (4aS,8R,8aS)-6-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine.
| Compound Name | (4aS,8R,8aS)-6-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
|---|---|
| PubChem CID | 97387561 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (4aS,8R,8aS)-6-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
| SMILES | CN(C)[C@@H]1CN(c2ncc(F)cn2)C[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C14H21FN4O/c1-18(2)12-9-19(14-16-6-11(15)7-17-14)8-10-4-3-5-20-13(10)12/h6-7,10,12-13H,3-5,8-9H2,1-2H3/t10-,12+,13-/m0/s1 |
| InChIKey | BHXFBVUPYGQGMU-UHTWSYAYSA-N |
| XLogP | 1.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |