C19H31N3O2 — CID 97387566
[(4aS,8R,8aS)-8-[methyl(propan-2-yl)amino]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2,5-dimethyl-1H-pyrrol-3-yl)methanone (PubChem CID 97387566) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is [(4aS,8R,8aS)-8-[methyl(propan-2-yl)amino]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2,5-dimethyl-1H-pyrrol-3-yl)methanone.
| Compound Name | [(4aS,8R,8aS)-8-[methyl(propan-2-yl)amino]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2,5-dimethyl-1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 97387566 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | [(4aS,8R,8aS)-8-[methyl(propan-2-yl)amino]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2,5-dimethyl-1H-pyrrol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2C[C@@H]3CCCO[C@@H]3[C@H](N(C)C(C)C)C2)c(C)[nH]1 |
| InChI | InChI=1S/C19H31N3O2/c1-12(2)21(5)17-11-22(10-15-7-6-8-24-18(15)17)19(23)16-9-13(3)20-14(16)4/h9,12,15,17-18,20H,6-8,10-11H2,1-5H3/t15-,17+,18-/m0/s1 |
| InChIKey | RPNQBUVNEFRXEH-JQHSSLGASA-N |
| XLogP | 2.59 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |