C14H21N3O — CID 97387591
(4aS,8R,8aS)-6-methyl-N-pyridin-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine (PubChem CID 97387591) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is (4aS,8R,8aS)-6-methyl-N-pyridin-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine.
| Compound Name | (4aS,8R,8aS)-6-methyl-N-pyridin-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
|---|---|
| PubChem CID | 97387591 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (4aS,8R,8aS)-6-methyl-N-pyridin-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
| SMILES | CN1C[C@@H]2CCCO[C@@H]2[C@H](Nc2ccccn2)C1 |
| InChI | InChI=1S/C14H21N3O/c1-17-9-11-5-4-8-18-14(11)12(10-17)16-13-6-2-3-7-15-13/h2-3,6-7,11-12,14H,4-5,8-10H2,1H3,(H,15,16)/t11-,12+,14-/m0/s1 |
| InChIKey | KTQLZUUQFIGEMF-SCRDCRAPSA-N |
| XLogP | 1.60 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |