C19H21FN4O2 — CID 97388605
(2S,3aS,7aS)-6-[(3-fluorophenyl)methyl]-N-pyrazin-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 97388605) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is (2S,3aS,7aS)-6-[(3-fluorophenyl)methyl]-N-pyrazin-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-6-[(3-fluorophenyl)methyl]-N-pyrazin-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 97388605 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2S,3aS,7aS)-6-[(3-fluorophenyl)methyl]-N-pyrazin-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cnccn1)[C@@H]1C[C@@H]2CCN(Cc3cccc(F)c3)C[C@H]2O1 |
| InChI | InChI=1S/C19H21FN4O2/c20-15-3-1-2-13(8-15)11-24-7-4-14-9-16(26-17(14)12-24)19(25)23-18-10-21-5-6-22-18/h1-3,5-6,8,10,14,16-17H,4,7,9,11-12H2,(H,22,23,25)/t14-,16-,17+/m0/s1 |
| InChIKey | UUMCTSXFGHGDBT-BHYGNILZSA-N |
| XLogP | 2.23 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |