C17H25N3O4 — CID 97388789
[(4R,4aS,8aR)-4-(5-methyl-1,3,4-oxadiazol-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(oxan-4-yl)methanone (PubChem CID 97388789) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(4R,4aS,8aR)-4-(5-methyl-1,3,4-oxadiazol-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(oxan-4-yl)methanone.
| Compound Name | [(4R,4aS,8aR)-4-(5-methyl-1,3,4-oxadiazol-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 97388789 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [(4R,4aS,8aR)-4-(5-methyl-1,3,4-oxadiazol-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(oxan-4-yl)methanone |
| SMILES | Cc1nnc([C@@H]2CCO[C@@H]3CCN(C(=O)C4CCOCC4)C[C@@H]32)o1 |
| InChI | InChI=1S/C17H25N3O4/c1-11-18-19-16(24-11)13-5-9-23-15-2-6-20(10-14(13)15)17(21)12-3-7-22-8-4-12/h12-15H,2-10H2,1H3/t13-,14-,15-/m1/s1 |
| InChIKey | URCBKFGDBNKKMH-RBSFLKMASA-N |
| XLogP | 1.53 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |