C17H22N6O — CID 97390233
2-cyclopropyl-N-[(7-pyrimidin-2-yl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl)methyl]acetamide (PubChem CID 97390233) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(7-pyrimidin-2-yl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl)methyl]acetamide.
| Compound Name | 2-cyclopropyl-N-[(7-pyrimidin-2-yl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 97390233 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 2-cyclopropyl-N-[(7-pyrimidin-2-yl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl)methyl]acetamide |
| SMILES | O=C(CC1CC1)NCc1cnc2n1CCN(c1ncccn1)CC2 |
| InChI | InChI=1S/C17H22N6O/c24-16(10-13-2-3-13)21-12-14-11-20-15-4-7-22(8-9-23(14)15)17-18-5-1-6-19-17/h1,5-6,11,13H,2-4,7-10,12H2,(H,21,24) |
| InChIKey | ZGLHOEWHNXTISD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |