C16H24N4 — CID 97393463
(5S)-9-(6-methylpyridazin-3-yl)-1-prop-2-enyl-1,9-diazaspiro[4.5]decane (PubChem CID 97393463) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is (5S)-9-(6-methylpyridazin-3-yl)-1-prop-2-enyl-1,9-diazaspiro[4.5]decane.
| Compound Name | (5S)-9-(6-methylpyridazin-3-yl)-1-prop-2-enyl-1,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 97393463 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (5S)-9-(6-methylpyridazin-3-yl)-1-prop-2-enyl-1,9-diazaspiro[4.5]decane |
| SMILES | C=CCN1CCC[C@@]12CCCN(c1ccc(C)nn1)C2 |
| InChI | InChI=1S/C16H24N4/c1-3-10-20-12-5-9-16(20)8-4-11-19(13-16)15-7-6-14(2)17-18-15/h3,6-7H,1,4-5,8-13H2,2H3/t16-/m1/s1 |
| InChIKey | INSIWRZSLYTGEF-MRXNPFEDSA-N |
| XLogP | 2.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|