C16H24N2 — CID 97397493
(4R)-1-ethyl-7-(2-phenylethyl)-1,7-diazaspiro[3.4]octane (PubChem CID 97397493) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (4R)-1-ethyl-7-(2-phenylethyl)-1,7-diazaspiro[3.4]octane.
| Compound Name | (4R)-1-ethyl-7-(2-phenylethyl)-1,7-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 97397493 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (4R)-1-ethyl-7-(2-phenylethyl)-1,7-diazaspiro[3.4]octane |
| SMILES | CCN1CC[C@]12CCN(CCc1ccccc1)C2 |
| InChI | InChI=1S/C16H24N2/c1-2-18-13-10-16(18)9-12-17(14-16)11-8-15-6-4-3-5-7-15/h3-7H,2,8-14H2,1H3/t16-/m0/s1 |
| InChIKey | ZQOAVMWMIOCHFC-INIZCTEOSA-N |
| XLogP | 2.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |