C19H19N5O2 — CID 97404919
[4-(4-methylanilino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(1,2-oxazol-5-yl)methanone (PubChem CID 97404919) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is [4-(4-methylanilino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(1,2-oxazol-5-yl)methanone.
| Compound Name | [4-(4-methylanilino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 97404919 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [4-(4-methylanilino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(1,2-oxazol-5-yl)methanone |
| SMILES | Cc1ccc(Nc2ncnc3c2CCN(C(=O)c2ccno2)CC3)cc1 |
| InChI | InChI=1S/C19H19N5O2/c1-13-2-4-14(5-3-13)23-18-15-7-10-24(11-8-16(15)20-12-21-18)19(25)17-6-9-22-26-17/h2-6,9,12H,7-8,10-11H2,1H3,(H,20,21,23) |
| InChIKey | OFXGIUQTHHVSIR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |