C16H18N6OS — CID 97404961
(1-methylpyrrol-2-yl)-[3-[(1,3-thiazol-2-ylamino)methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]methanone (PubChem CID 97404961) has the molecular formula C16H18N6OS and a molecular weight of 342.43 g/mol. Its IUPAC name is (1-methylpyrrol-2-yl)-[3-[(1,3-thiazol-2-ylamino)methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]methanone.
| Compound Name | (1-methylpyrrol-2-yl)-[3-[(1,3-thiazol-2-ylamino)methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 97404961 |
| Molecular Formula | C16H18N6OS |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (1-methylpyrrol-2-yl)-[3-[(1,3-thiazol-2-ylamino)methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]methanone |
| SMILES | Cn1cccc1C(=O)N1CCc2c(CNc3nccs3)n[nH]c2C1 |
| InChI | InChI=1S/C16H18N6OS/c1-21-6-2-3-14(21)15(23)22-7-4-11-12(19-20-13(11)10-22)9-18-16-17-5-8-24-16/h2-3,5-6,8H,4,7,9-10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | AELMBFBRLJAZBP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |