C16H21N7 — CID 97405795
7-[(3-methylimidazol-4-yl)methyl]-3-(pyrrol-1-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine (PubChem CID 97405795) has the molecular formula C16H21N7 and a molecular weight of 311.39 g/mol. Its IUPAC name is 7-[(3-methylimidazol-4-yl)methyl]-3-(pyrrol-1-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine.
| Compound Name | 7-[(3-methylimidazol-4-yl)methyl]-3-(pyrrol-1-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
|---|---|
| PubChem CID | 97405795 |
| Molecular Formula | C16H21N7 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 7-[(3-methylimidazol-4-yl)methyl]-3-(pyrrol-1-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
| SMILES | Cn1cncc1CN1CCc2nnc(Cn3cccc3)n2CC1 |
| InChI | InChI=1S/C16H21N7/c1-20-13-17-10-14(20)11-22-7-4-15-18-19-16(23(15)9-8-22)12-21-5-2-3-6-21/h2-3,5-6,10,13H,4,7-9,11-12H2,1H3 |
| InChIKey | VEFGXDYHEAPIEI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |