C17H30F3N3 — CID 97409932
(3aS,4R,7aS)-4-[(4-methylpiperazin-1-yl)methyl]-2-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 97409932) has the molecular formula C17H30F3N3 and a molecular weight of 333.44 g/mol. Its IUPAC name is (3aS,4R,7aS)-4-[(4-methylpiperazin-1-yl)methyl]-2-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,4R,7aS)-4-[(4-methylpiperazin-1-yl)methyl]-2-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 97409932 |
| Molecular Formula | C17H30F3N3 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | (3aS,4R,7aS)-4-[(4-methylpiperazin-1-yl)methyl]-2-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CN1CCN(C[C@@H]2CCC[C@@H]3CN(CCC(F)(F)F)C[C@@H]32)CC1 |
| InChI | InChI=1S/C17H30F3N3/c1-21-7-9-22(10-8-21)11-14-3-2-4-15-12-23(13-16(14)15)6-5-17(18,19)20/h14-16H,2-13H2,1H3/t14-,15+,16+/m0/s1 |
| InChIKey | FTFRFDJKOKZYAL-ARFHVFGLSA-N |
| XLogP | 2.53 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |