C16H24N4O2 — CID 97420218
[(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1-methylpyrazol-3-yl)methanone (PubChem CID 97420218) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1-methylpyrazol-3-yl)methanone.
| Compound Name | [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 97420218 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1-methylpyrazol-3-yl)methanone |
| SMILES | Cn1ccc(C(=O)N2C[C@@H]3CN(CC4CC4)CCO[C@@H]3C2)n1 |
| InChI | InChI=1S/C16H24N4O2/c1-18-5-4-14(17-18)16(21)20-10-13-9-19(8-12-2-3-12)6-7-22-15(13)11-20/h4-5,12-13,15H,2-3,6-11H2,1H3/t13-,15+/m0/s1 |
| InChIKey | WBNIPXLKBJPZSO-DZGCQCFKSA-N |
| XLogP | 0.60 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |