C14H19FN4O3S — CID 97420275
(5aR,8aS)-4-cyclopropylsulfonyl-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine (PubChem CID 97420275) has the molecular formula C14H19FN4O3S and a molecular weight of 342.40 g/mol. Its IUPAC name is (5aR,8aS)-4-cyclopropylsulfonyl-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine.
| Compound Name | (5aR,8aS)-4-cyclopropylsulfonyl-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
|---|---|
| PubChem CID | 97420275 |
| Molecular Formula | C14H19FN4O3S |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (5aR,8aS)-4-cyclopropylsulfonyl-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
| SMILES | O=S(=O)(C1CC1)N1CCO[C@@H]2CN(c3ncc(F)cn3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H19FN4O3S/c15-11-5-16-14(17-6-11)18-7-10-8-19(3-4-22-13(10)9-18)23(20,21)12-1-2-12/h5-6,10,12-13H,1-4,7-9H2/t10-,13-/m1/s1 |
| InChIKey | BXENYLQDVZPCAK-ZWNOBZJWSA-N |
| XLogP | 0.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |