C23H32N4O — CID 97435294
(E)-3-(1-adamantyl)-N-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]but-2-enamide (PubChem CID 97435294) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is (E)-3-(1-adamantyl)-N-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]but-2-enamide.
| Compound Name | (E)-3-(1-adamantyl)-N-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]but-2-enamide |
|---|---|
| PubChem CID | 97435294 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (E)-3-(1-adamantyl)-N-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]but-2-enamide |
| SMILES | C/C(=C\C(=O)N[C@@H]1CCCN(c2ncccn2)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H32N4O/c1-16(23-12-17-9-18(13-23)11-19(10-17)14-23)8-21(28)26-20-4-2-7-27(15-20)22-24-5-3-6-25-22/h3,5-6,8,17-20H,2,4,7,9-15H2,1H3,(H,26,28)/b16-8+/t17?,18?,19?,20-,23?/m1/s1 |
| InChIKey | QAZKXJHBTDCHDN-OGHXQHQOSA-N |
| XLogP | 3.72 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|