C22H25N3O3 — CID 97436409
(4S)-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-4-phenylazepane-1-carboxamide (PubChem CID 97436409) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (4S)-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-4-phenylazepane-1-carboxamide.
| Compound Name | (4S)-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-4-phenylazepane-1-carboxamide |
|---|---|
| PubChem CID | 97436409 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (4S)-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-4-phenylazepane-1-carboxamide |
| SMILES | CN1C(=O)COc2ccc(NC(=O)N3CCC[C@H](c4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C22H25N3O3/c1-24-19-14-18(9-10-20(19)28-15-21(24)26)23-22(27)25-12-5-8-17(11-13-25)16-6-3-2-4-7-16/h2-4,6-7,9-10,14,17H,5,8,11-13,15H2,1H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | PHGTZUONOLAEJT-KRWDZBQOSA-N |
| XLogP | 3.84 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |