C20H23N7O — CID 97438298
1-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-3-[[2-(1,2,4-triazol-1-yl)phenyl]methyl]urea (PubChem CID 97438298) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-3-[[2-(1,2,4-triazol-1-yl)phenyl]methyl]urea.
| Compound Name | 1-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-3-[[2-(1,2,4-triazol-1-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 97438298 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-3-[[2-(1,2,4-triazol-1-yl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1-n1cncn1)Nc1ccnn1C[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C20H23N7O/c28-20(22-12-17-8-4-5-9-18(17)27-15-21-14-24-27)25-19-10-11-23-26(19)13-16-6-2-1-3-7-16/h1-2,4-5,8-11,14-16H,3,6-7,12-13H2,(H2,22,25,28)/t16-/m1/s1 |
| InChIKey | KZDUKRJUQHCKJL-MRXNPFEDSA-N |
| XLogP | 3.14 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|