C21H27N5O2 — CID 72930262
N-[2-(cyclohex-3-en-1-ylmethyl)pyrazol-3-yl]-4-hydroxy-4-pyridin-3-ylpiperidine-1-carboxamide (PubChem CID 72930262) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[2-(cyclohex-3-en-1-ylmethyl)pyrazol-3-yl]-4-hydroxy-4-pyridin-3-ylpiperidine-1-carboxamide.
| Compound Name | N-[2-(cyclohex-3-en-1-ylmethyl)pyrazol-3-yl]-4-hydroxy-4-pyridin-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 72930262 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[2-(cyclohex-3-en-1-ylmethyl)pyrazol-3-yl]-4-hydroxy-4-pyridin-3-ylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1ccnn1CC1CC=CCC1)N1CCC(O)(c2cccnc2)CC1 |
| InChI | InChI=1S/C21H27N5O2/c27-20(24-19-8-12-23-26(19)16-17-5-2-1-3-6-17)25-13-9-21(28,10-14-25)18-7-4-11-22-15-18/h1-2,4,7-8,11-12,15,17,28H,3,5-6,9-10,13-14,16H2,(H,24,27) |
| InChIKey | XZSVCIFTBIELGR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|