C21H29N5O3 — CID 97439229
(3aS,6aR)-5-ethyl-N,N-dimethyl-6-oxo-1'-(pyridine-4-carbonyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-carboxamide (PubChem CID 97439229) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is (3aS,6aR)-5-ethyl-N,N-dimethyl-6-oxo-1'-(pyridine-4-carbonyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-carboxamide.
| Compound Name | (3aS,6aR)-5-ethyl-N,N-dimethyl-6-oxo-1'-(pyridine-4-carbonyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-carboxamide |
|---|---|
| PubChem CID | 97439229 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (3aS,6aR)-5-ethyl-N,N-dimethyl-6-oxo-1'-(pyridine-4-carbonyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-carboxamide |
| SMILES | CCN1C(=O)[C@H]2CN(C(=O)N(C)C)C[C@H]2C12CCN(C(=O)c1ccncc1)CC2 |
| InChI | InChI=1S/C21H29N5O3/c1-4-26-19(28)16-13-25(20(29)23(2)3)14-17(16)21(26)7-11-24(12-8-21)18(27)15-5-9-22-10-6-15/h5-6,9-10,16-17H,4,7-8,11-14H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | USCKBFOXLBXLNY-DLBZAZTESA-N |
| XLogP | 1.15 |
| TPSA | 77.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |