C21H31N3O3 — CID 97440858
(3aR,8aR)-1-ethyl-6-(3-methoxybenzoyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide (PubChem CID 97440858) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is (3aR,8aR)-1-ethyl-6-(3-methoxybenzoyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide.
| Compound Name | (3aR,8aR)-1-ethyl-6-(3-methoxybenzoyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide |
|---|---|
| PubChem CID | 97440858 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (3aR,8aR)-1-ethyl-6-(3-methoxybenzoyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide |
| SMILES | CCN1CC[C@@]2(C(=O)N(C)C)CCN(C(=O)c3cccc(OC)c3)CC[C@@H]12 |
| InChI | InChI=1S/C21H31N3O3/c1-5-23-13-10-21(20(26)22(2)3)11-14-24(12-9-18(21)23)19(25)16-7-6-8-17(15-16)27-4/h6-8,15,18H,5,9-14H2,1-4H3/t18-,21-/m1/s1 |
| InChIKey | YEULQCBRHIRTQC-WIYYLYMNSA-N |
| XLogP | 2.10 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |