C18H30N4O2S — CID 97441088
(3aR,8aR)-6-(5-ethylpyrimidin-2-yl)-2-(3-methylbutyl)-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide (PubChem CID 97441088) has the molecular formula C18H30N4O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is (3aR,8aR)-6-(5-ethylpyrimidin-2-yl)-2-(3-methylbutyl)-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide.
| Compound Name | (3aR,8aR)-6-(5-ethylpyrimidin-2-yl)-2-(3-methylbutyl)-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide |
|---|---|
| PubChem CID | 97441088 |
| Molecular Formula | C18H30N4O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (3aR,8aR)-6-(5-ethylpyrimidin-2-yl)-2-(3-methylbutyl)-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide |
| SMILES | CCc1cnc(N2CC[C@@H]3CN(CCC(C)C)S(=O)(=O)[C@@H]3CC2)nc1 |
| InChI | InChI=1S/C18H30N4O2S/c1-4-15-11-19-18(20-12-15)21-8-6-16-13-22(10-5-14(2)3)25(23,24)17(16)7-9-21/h11-12,14,16-17H,4-10,13H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | FIHJKFSKJOZLKV-IAGOWNOFSA-N |
| XLogP | 2.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |