C13H16FN5O — CID 97455583
1-(2-fluoro-3-pyridinyl)-3-[(1S)-1-(5-methyl-1H-imidazol-2-yl)propyl]urea (PubChem CID 97455583) has the molecular formula C13H16FN5O and a molecular weight of 277.30 g/mol. Its IUPAC name is 1-(2-fluoro-3-pyridinyl)-3-[(1S)-1-(5-methyl-1H-imidazol-2-yl)propyl]urea.
| Compound Name | 1-(2-fluoro-3-pyridinyl)-3-[(1S)-1-(5-methyl-1H-imidazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 97455583 |
| Molecular Formula | C13H16FN5O |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-(2-fluoro-3-pyridinyl)-3-[(1S)-1-(5-methyl-1H-imidazol-2-yl)propyl]urea |
| SMILES | CC[C@H](NC(=O)Nc1cccnc1F)c1ncc(C)[nH]1 |
| InChI | InChI=1S/C13H16FN5O/c1-3-9(12-16-7-8(2)17-12)18-13(20)19-10-5-4-6-15-11(10)14/h4-7,9H,3H2,1-2H3,(H,16,17)(H2,18,19,20)/t9-/m0/s1 |
| InChIKey | GMAAZIYZFLHHCO-VIFPVBQESA-N |
| XLogP | 2.53 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|