C20H29N5 — CID 97458264
(3aR,4S,7aS)-N-methyl-2-[(1-methylpyrazol-4-yl)methyl]-N-(pyridin-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine (PubChem CID 97458264) has the molecular formula C20H29N5 and a molecular weight of 339.49 g/mol. Its IUPAC name is (3aR,4S,7aS)-N-methyl-2-[(1-methylpyrazol-4-yl)methyl]-N-(pyridin-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine.
| Compound Name | (3aR,4S,7aS)-N-methyl-2-[(1-methylpyrazol-4-yl)methyl]-N-(pyridin-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine |
|---|---|
| PubChem CID | 97458264 |
| Molecular Formula | C20H29N5 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | (3aR,4S,7aS)-N-methyl-2-[(1-methylpyrazol-4-yl)methyl]-N-(pyridin-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine |
| SMILES | CN(Cc1ccncc1)[C@H]1CCC[C@@H]2CN(Cc3cnn(C)c3)C[C@@H]21 |
| InChI | InChI=1S/C20H29N5/c1-23(11-16-6-8-21-9-7-16)20-5-3-4-18-14-25(15-19(18)20)13-17-10-22-24(2)12-17/h6-10,12,18-20H,3-5,11,13-15H2,1-2H3/t18-,19+,20+/m1/s1 |
| InChIKey | ADHYITZDOBGGLQ-AABGKKOBSA-N |
| XLogP | 2.55 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |