C19H26N4 — CID 110138515
(3aR,4R,7aS)-2-[(1-methylpyrazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 110138515) has the molecular formula C19H26N4 and a molecular weight of 310.44 g/mol. Its IUPAC name is (3aR,4R,7aS)-2-[(1-methylpyrazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aR,4R,7aS)-2-[(1-methylpyrazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 110138515 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | (3aR,4R,7aS)-2-[(1-methylpyrazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | Cn1cc(CN2C[C@H]3CCC[C@H](Cc4cccnc4)[C@H]3C2)cn1 |
| InChI | InChI=1S/C19H26N4/c1-22-11-16(10-21-22)12-23-13-18-6-2-5-17(19(18)14-23)8-15-4-3-7-20-9-15/h3-4,7,9-11,17-19H,2,5-6,8,12-14H2,1H3/t17-,18-,19-/m1/s1 |
| InChIKey | RPLQWDWACKKMFM-GUDVDZBRSA-N |
| XLogP | 2.91 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |