C18H30N6O — CID 97460261
(2R,3aS,6aS)-N-[2-(dimethylamino)ethyl]-1-propan-2-yl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide (PubChem CID 97460261) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is (2R,3aS,6aS)-N-[2-(dimethylamino)ethyl]-1-propan-2-yl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide.
| Compound Name | (2R,3aS,6aS)-N-[2-(dimethylamino)ethyl]-1-propan-2-yl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97460261 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (2R,3aS,6aS)-N-[2-(dimethylamino)ethyl]-1-propan-2-yl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
| SMILES | CC(C)N1[C@@H](C(=O)NCCN(C)C)C[C@H]2CN(c3ncccn3)C[C@H]21 |
| InChI | InChI=1S/C18H30N6O/c1-13(2)24-15(17(25)19-8-9-22(3)4)10-14-11-23(12-16(14)24)18-20-6-5-7-21-18/h5-7,13-16H,8-12H2,1-4H3,(H,19,25)/t14-,15+,16+/m0/s1 |
| InChIKey | YHPZJAVDVLJLNK-ARFHVFGLSA-N |
| XLogP | 0.44 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |