C14H19Cl2N3O — CID 97465011
(1E)-1-[[(1R,6S)-2,6-dichlorocyclohexa-2,4-dien-1-yl]hydrazinylidene]-1-piperidin-1-ylpropan-2-one (PubChem CID 97465011) has the molecular formula C14H19Cl2N3O and a molecular weight of 316.23 g/mol. Its IUPAC name is (1E)-1-[[(1R,6S)-2,6-dichlorocyclohexa-2,4-dien-1-yl]hydrazinylidene]-1-piperidin-1-ylpropan-2-one.
| Compound Name | (1E)-1-[[(1R,6S)-2,6-dichlorocyclohexa-2,4-dien-1-yl]hydrazinylidene]-1-piperidin-1-ylpropan-2-one |
|---|---|
| PubChem CID | 97465011 |
| Molecular Formula | C14H19Cl2N3O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (1E)-1-[[(1R,6S)-2,6-dichlorocyclohexa-2,4-dien-1-yl]hydrazinylidene]-1-piperidin-1-ylpropan-2-one |
| SMILES | CC(=O)/C(=N\N[C@H]1C(Cl)=CC=C[C@@H]1Cl)N1CCCCC1 |
| InChI | InChI=1S/C14H19Cl2N3O/c1-10(20)14(19-8-3-2-4-9-19)18-17-13-11(15)6-5-7-12(13)16/h5-7,11,13,17H,2-4,8-9H2,1H3/b18-14+/t11-,13+/m0/s1 |
| InChIKey | JQWMUVYHEKJNMI-ZMJIVUTCSA-N |
| XLogP | 2.63 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|