C16H21N5O3 — CID 97465054
2-[4-[(1-methyltetrazol-5-yl)methoxy]phenyl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 97465054) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-[4-[(1-methyltetrazol-5-yl)methoxy]phenyl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[4-[(1-methyltetrazol-5-yl)methoxy]phenyl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97465054 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-[4-[(1-methyltetrazol-5-yl)methoxy]phenyl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | Cn1nnnc1COc1ccc(CC(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C16H21N5O3/c1-21-15(18-19-20-21)11-24-13-6-4-12(5-7-13)9-16(22)17-10-14-3-2-8-23-14/h4-7,14H,2-3,8-11H2,1H3,(H,17,22)/t14-/m0/s1 |
| InChIKey | XHQMZKFKTHZWJT-AWEZNQCLSA-N |
| XLogP | 0.63 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |