C20H21N3O — CID 97466813
3-[(2-oxo-1-prop-2-enyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl)methyl]benzonitrile (PubChem CID 97466813) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-[(2-oxo-1-prop-2-enyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl)methyl]benzonitrile.
| Compound Name | 3-[(2-oxo-1-prop-2-enyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 97466813 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 3-[(2-oxo-1-prop-2-enyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl)methyl]benzonitrile |
| SMILES | C=CCn1c2c(ccc1=O)CCN(Cc1cccc(C#N)c1)CC2 |
| InChI | InChI=1S/C20H21N3O/c1-2-10-23-19-9-12-22(11-8-18(19)6-7-20(23)24)15-17-5-3-4-16(13-17)14-21/h2-7,13H,1,8-12,15H2 |
| InChIKey | INHFXEOWPPWINU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|