C17H18FNO3S — CID 97470103
(2S,3R)-2-benzyl-1-(3-fluorophenyl)sulfonylpyrrolidin-3-ol (PubChem CID 97470103) has the molecular formula C17H18FNO3S and a molecular weight of 335.40 g/mol. Its IUPAC name is (2S,3R)-2-benzyl-1-(3-fluorophenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (2S,3R)-2-benzyl-1-(3-fluorophenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 97470103 |
| Molecular Formula | C17H18FNO3S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (2S,3R)-2-benzyl-1-(3-fluorophenyl)sulfonylpyrrolidin-3-ol |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CC[C@@H](O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H18FNO3S/c18-14-7-4-8-15(12-14)23(21,22)19-10-9-17(20)16(19)11-13-5-2-1-3-6-13/h1-8,12,16-17,20H,9-11H2/t16-,17+/m0/s1 |
| InChIKey | VBNCNDRWMUADRD-DLBZAZTESA-N |
| XLogP | 2.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |