C14H18N4O3 — CID 97477187
[(3aR,6aR)-5-pyrimidin-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 97477187) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is [(3aR,6aR)-5-pyrimidin-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(3aR,6aR)-5-pyrimidin-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 97477187 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [(3aR,6aR)-5-pyrimidin-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | O=C(N1CCCO1)[C@]12COC[C@H]1CN(c1ncccn1)C2 |
| InChI | InChI=1S/C14H18N4O3/c19-12(18-5-2-6-21-18)14-9-17(7-11(14)8-20-10-14)13-15-3-1-4-16-13/h1,3-4,11H,2,5-10H2/t11-,14-/m1/s1 |
| InChIKey | HQOQSAQZBMPQFV-BXUZGUMPSA-N |
| XLogP | 0.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |