C17H20N4O3 — CID 97483220
[(2S,3aS,6aS)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(4-methyl-2-pyridinyl)methanone (PubChem CID 97483220) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is [(2S,3aS,6aS)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(4-methyl-2-pyridinyl)methanone.
| Compound Name | [(2S,3aS,6aS)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(4-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 97483220 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | [(2S,3aS,6aS)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(4-methyl-2-pyridinyl)methanone |
| SMILES | Cc1ccnc(C(=O)N2C[C@@H]3C[C@@H](Cc4nc(C)no4)O[C@@H]3C2)c1 |
| InChI | InChI=1S/C17H20N4O3/c1-10-3-4-18-14(5-10)17(22)21-8-12-6-13(23-15(12)9-21)7-16-19-11(2)20-24-16/h3-5,12-13,15H,6-9H2,1-2H3/t12-,13-,15+/m0/s1 |
| InChIKey | SSWQPTQIXOPWQF-KCQAQPDRSA-N |
| XLogP | 1.55 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |