C16H19N3O4S — CID 97484194
(3R,3aS,6aS)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(2-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 97484194) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(2-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (3R,3aS,6aS)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(2-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 97484194 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (3R,3aS,6aS)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(2-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | Cc1noc([C@H]2CO[C@@H]3CN(S(=O)(=O)c4ccccc4C)C[C@H]23)n1 |
| InChI | InChI=1S/C16H19N3O4S/c1-10-5-3-4-6-15(10)24(20,21)19-7-12-13(9-22-14(12)8-19)16-17-11(2)18-23-16/h3-6,12-14H,7-9H2,1-2H3/t12-,13+,14-/m1/s1 |
| InChIKey | MRAHQNKHIIDXOV-HZSPNIEDSA-N |
| XLogP | 1.49 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |