C14H18N4O4S — CID 97485111
N-(furan-2-ylmethyl)-2-[(3R)-4-methylsulfonylmorpholin-3-yl]pyrimidin-4-amine (PubChem CID 97485111) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(3R)-4-methylsulfonylmorpholin-3-yl]pyrimidin-4-amine.
| Compound Name | N-(furan-2-ylmethyl)-2-[(3R)-4-methylsulfonylmorpholin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 97485111 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(3R)-4-methylsulfonylmorpholin-3-yl]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)N1CCOC[C@H]1c1nccc(NCc2ccco2)n1 |
| InChI | InChI=1S/C14H18N4O4S/c1-23(19,20)18-6-8-21-10-12(18)14-15-5-4-13(17-14)16-9-11-3-2-7-22-11/h2-5,7,12H,6,8-10H2,1H3,(H,15,16,17)/t12-/m0/s1 |
| InChIKey | XFGKKLKTKPZIFJ-LBPRGKRZSA-N |
| XLogP | 1.01 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |