C16H23F3N4O6S — CID 155836444
2-(4-cyclopropylsulfonylmorpholin-3-yl)-N-(2-methoxyethyl)pyrimidin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 155836444) has the molecular formula C16H23F3N4O6S and a molecular weight of 456.44 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylmorpholin-3-yl)-N-(2-methoxyethyl)pyrimidin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(4-cyclopropylsulfonylmorpholin-3-yl)-N-(2-methoxyethyl)pyrimidin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155836444 |
| Molecular Formula | C16H23F3N4O6S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-(4-cyclopropylsulfonylmorpholin-3-yl)-N-(2-methoxyethyl)pyrimidin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | COCCNc1ccnc(C2COCCN2S(=O)(=O)C2CC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N4O4S.C2HF3O2/c1-21-8-6-15-13-4-5-16-14(17-13)12-10-22-9-7-18(12)23(19,20)11-2-3-11;3-2(4,5)1(6)7/h4-5,11-12H,2-3,6-10H2,1H3,(H,15,16,17);(H,6,7) |
| InChIKey | DUJPPQAATJHJTK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|