C16H20N6O3 — CID 131643119
[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-pyridazin-4-ylmethanone (PubChem CID 131643119) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is [3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-pyridazin-4-ylmethanone.
| Compound Name | [3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 131643119 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-pyridazin-4-ylmethanone |
| SMILES | COCCNc1ccnc(C2COCCN2C(=O)c2ccnnc2)n1 |
| InChI | InChI=1S/C16H20N6O3/c1-24-8-6-17-14-3-4-18-15(21-14)13-11-25-9-7-22(13)16(23)12-2-5-19-20-10-12/h2-5,10,13H,6-9,11H2,1H3,(H,17,18,21) |
| InChIKey | RHGRLSLEIZZIFD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|