C13H20N4O3S — CID 97485736
N-(cyclopropylmethyl)-2-[(3R)-4-methylsulfonylmorpholin-3-yl]pyrimidin-4-amine (PubChem CID 97485736) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[(3R)-4-methylsulfonylmorpholin-3-yl]pyrimidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-2-[(3R)-4-methylsulfonylmorpholin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 97485736 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[(3R)-4-methylsulfonylmorpholin-3-yl]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)N1CCOC[C@H]1c1nccc(NCC2CC2)n1 |
| InChI | InChI=1S/C13H20N4O3S/c1-21(18,19)17-6-7-20-9-11(17)13-14-5-4-12(16-13)15-8-10-2-3-10/h4-5,10-11H,2-3,6-9H2,1H3,(H,14,15,16)/t11-/m0/s1 |
| InChIKey | IATIZTMVBGBNID-NSHDSACASA-N |
| XLogP | 0.63 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |