C18H23N5O — CID 97487233
N-(cyclopropylmethyl)-2-[(3S)-4-(pyridin-2-ylmethyl)morpholin-3-yl]pyrimidin-4-amine (PubChem CID 97487233) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[(3S)-4-(pyridin-2-ylmethyl)morpholin-3-yl]pyrimidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-2-[(3S)-4-(pyridin-2-ylmethyl)morpholin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 97487233 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[(3S)-4-(pyridin-2-ylmethyl)morpholin-3-yl]pyrimidin-4-amine |
| SMILES | c1ccc(CN2CCOC[C@@H]2c2nccc(NCC3CC3)n2)nc1 |
| InChI | InChI=1S/C18H23N5O/c1-2-7-19-15(3-1)12-23-9-10-24-13-16(23)18-20-8-6-17(22-18)21-11-14-4-5-14/h1-3,6-8,14,16H,4-5,9-13H2,(H,20,21,22)/t16-/m1/s1 |
| InChIKey | LEDNBABZBDOXGB-MRXNPFEDSA-N |
| XLogP | 2.27 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |