C18H19N5O2 — CID 97485536
2-[(3S)-4-(furan-3-ylmethyl)morpholin-3-yl]-N-pyridin-2-ylpyrimidin-4-amine (PubChem CID 97485536) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[(3S)-4-(furan-3-ylmethyl)morpholin-3-yl]-N-pyridin-2-ylpyrimidin-4-amine.
| Compound Name | 2-[(3S)-4-(furan-3-ylmethyl)morpholin-3-yl]-N-pyridin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 97485536 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[(3S)-4-(furan-3-ylmethyl)morpholin-3-yl]-N-pyridin-2-ylpyrimidin-4-amine |
| SMILES | c1ccc(Nc2ccnc([C@H]3COCCN3Cc3ccoc3)n2)nc1 |
| InChI | InChI=1S/C18H19N5O2/c1-2-6-19-16(3-1)21-17-4-7-20-18(22-17)15-13-25-10-8-23(15)11-14-5-9-24-12-14/h1-7,9,12,15H,8,10-11,13H2,(H,19,20,21,22)/t15-/m1/s1 |
| InChIKey | YKLXZSPQECNXLM-OAHLLOKOSA-N |
| XLogP | 2.78 |
| TPSA | 76.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |