C19H27NO4 — CID 97485211
1-[(3aS,7S,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-3-(4-ethoxyphenyl)propan-1-one (PubChem CID 97485211) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-[(3aS,7S,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-3-(4-ethoxyphenyl)propan-1-one.
| Compound Name | 1-[(3aS,7S,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-3-(4-ethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 97485211 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-[(3aS,7S,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-3-(4-ethoxyphenyl)propan-1-one |
| SMILES | CCOc1ccc(CCC(=O)N2CC[C@H](OC)[C@H]3OCC[C@@H]32)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-3-23-15-7-4-14(5-8-15)6-9-18(21)20-12-10-17(22-2)19-16(20)11-13-24-19/h4-5,7-8,16-17,19H,3,6,9-13H2,1-2H3/t16-,17-,19-/m0/s1 |
| InChIKey | OCXCCGBWVRQKOR-LNLFQRSKSA-N |
| XLogP | 2.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |