C14H16FN5O2 — CID 97486587
(2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 97486587) has the molecular formula C14H16FN5O2 and a molecular weight of 305.31 g/mol. Its IUPAC name is (2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 97486587 |
| Molecular Formula | C14H16FN5O2 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | Cc1noc(C[C@@H]2C[C@H]3CN(c4ncc(F)cn4)C[C@H]3O2)n1 |
| InChI | InChI=1S/C14H16FN5O2/c1-8-18-13(22-19-8)3-11-2-9-6-20(7-12(9)21-11)14-16-4-10(15)5-17-14/h4-5,9,11-12H,2-3,6-7H2,1H3/t9-,11-,12+/m0/s1 |
| InChIKey | OZUOSTNBYABENE-ZMLRMANQSA-N |
| XLogP | 1.14 |
| TPSA | 77.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |