C14H21N3O3 — CID 97486922
(3aS,7R,7aS)-7-ethoxy-4-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine (PubChem CID 97486922) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is (3aS,7R,7aS)-7-ethoxy-4-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine.
| Compound Name | (3aS,7R,7aS)-7-ethoxy-4-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 97486922 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (3aS,7R,7aS)-7-ethoxy-4-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine |
| SMILES | CCO[C@@H]1CCN(c2cc(OC)ncn2)[C@H]2CCO[C@H]12 |
| InChI | InChI=1S/C14H21N3O3/c1-3-19-11-4-6-17(10-5-7-20-14(10)11)12-8-13(18-2)16-9-15-12/h8-11,14H,3-7H2,1-2H3/t10-,11+,14-/m0/s1 |
| InChIKey | CULKVHYPTLJLHQ-WDMOLILDSA-N |
| XLogP | 1.26 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |