C17H21N3O3S2 — CID 97488060
(3S)-N-pyridin-2-yl-8-thiophen-2-ylsulfonyl-1-oxa-8-azaspiro[4.5]decan-3-amine (PubChem CID 97488060) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is (3S)-N-pyridin-2-yl-8-thiophen-2-ylsulfonyl-1-oxa-8-azaspiro[4.5]decan-3-amine.
| Compound Name | (3S)-N-pyridin-2-yl-8-thiophen-2-ylsulfonyl-1-oxa-8-azaspiro[4.5]decan-3-amine |
|---|---|
| PubChem CID | 97488060 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (3S)-N-pyridin-2-yl-8-thiophen-2-ylsulfonyl-1-oxa-8-azaspiro[4.5]decan-3-amine |
| SMILES | O=S(=O)(c1cccs1)N1CCC2(CC1)C[C@H](Nc1ccccn1)CO2 |
| InChI | InChI=1S/C17H21N3O3S2/c21-25(22,16-5-3-11-24-16)20-9-6-17(7-10-20)12-14(13-23-17)19-15-4-1-2-8-18-15/h1-5,8,11,14H,6-7,9-10,12-13H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | QNFNBSUFKCSRQZ-AWEZNQCLSA-N |
| XLogP | 2.57 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |