C17H23N3O3 — CID 97494238
5-methyl-N-(2-oxo-1-prop-2-enyl-1-azaspiro[4.5]decan-8-yl)-1,2-oxazole-3-carboxamide (PubChem CID 97494238) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-methyl-N-(2-oxo-1-prop-2-enyl-1-azaspiro[4.5]decan-8-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-(2-oxo-1-prop-2-enyl-1-azaspiro[4.5]decan-8-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 97494238 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 5-methyl-N-(2-oxo-1-prop-2-enyl-1-azaspiro[4.5]decan-8-yl)-1,2-oxazole-3-carboxamide |
| SMILES | C=CCN1C(=O)CCC12CCC(NC(=O)c1cc(C)on1)CC2 |
| InChI | InChI=1S/C17H23N3O3/c1-3-10-20-15(21)6-9-17(20)7-4-13(5-8-17)18-16(22)14-11-12(2)23-19-14/h3,11,13H,1,4-10H2,2H3,(H,18,22) |
| InChIKey | HNTCXGUMVKSMQD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|