C20H17N3O6 — CID 97496690
2-[4-[(4S)-2,6-dioxo-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-4-yl]-2-methoxyphenoxy]acetamide (PubChem CID 97496690) has the molecular formula C20H17N3O6 and a molecular weight of 395.37 g/mol. Its IUPAC name is 2-[4-[(4S)-2,6-dioxo-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-4-yl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(4S)-2,6-dioxo-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-4-yl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 97496690 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[4-[(4S)-2,6-dioxo-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-4-yl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc([C@@H]2CC(=O)Oc3nc4ccccn4c(=O)c32)ccc1OCC(N)=O |
| InChI | InChI=1S/C20H17N3O6/c1-27-14-8-11(5-6-13(14)28-10-15(21)24)12-9-17(25)29-19-18(12)20(26)23-7-3-2-4-16(23)22-19/h2-8,12H,9-10H2,1H3,(H2,21,24)/t12-/m0/s1 |
| InChIKey | ZLWOYFFNPANHPG-LBPRGKRZSA-N |
| XLogP | 1.01 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |