C19H16N2O5 — CID 75490180
4-(2,4-dimethoxyphenyl)-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,6-dione (PubChem CID 75490180) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,6-dione.
| Compound Name | 4-(2,4-dimethoxyphenyl)-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,6-dione |
|---|---|
| PubChem CID | 75490180 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,6-dione |
| SMILES | COc1ccc(C2CC(=O)Oc3nc4ccccn4c(=O)c32)c(OC)c1 |
| InChI | InChI=1S/C19H16N2O5/c1-24-11-6-7-12(14(9-11)25-2)13-10-16(22)26-18-17(13)19(23)21-8-4-3-5-15(21)20-18/h3-9,13H,10H2,1-2H3 |
| InChIKey | URNZKUVVWVAIHW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |