C20H13NO4 — CID 977279
(1,3-dioxobenzo[de]isoquinolin-2-yl) 2-methylbenzoate (PubChem CID 977279) has the molecular formula C20H13NO4 and a molecular weight of 331.33 g/mol. Its IUPAC name is (1,3-dioxobenzo[de]isoquinolin-2-yl) 2-methylbenzoate.
| Compound Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) 2-methylbenzoate |
|---|---|
| PubChem CID | 977279 |
| Molecular Formula | C20H13NO4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)ON1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C20H13NO4/c1-12-6-2-3-9-14(12)20(24)25-21-18(22)15-10-4-7-13-8-5-11-16(17(13)15)19(21)23/h2-11H,1H3 |
| InChIKey | VCPSUHIJHZYCLU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|